C10H19FN2O3 — CID 90064529
(2R,3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)-1-methyl-2-[1-(methylamino)ethenyl]piperidine-3,4-diol (PubChem CID 90064529) has the molecular formula C10H19FN2O3 and a molecular weight of 234.27 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)-1-methyl-2-[1-(methylamino)ethenyl]piperidine-3,4-diol.
| Compound Name | (2R,3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)-1-methyl-2-[1-(methylamino)ethenyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 90064529 |
| Molecular Formula | C10H19FN2O3 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2R,3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)-1-methyl-2-[1-(methylamino)ethenyl]piperidine-3,4-diol |
| SMILES | C=C(NC)[C@@H]1[C@@H](O)[C@@H](O)[C@@H](F)[C@@H](CO)N1C |
| InChI | InChI=1S/C10H19FN2O3/c1-5(12-2)8-10(16)9(15)7(11)6(4-14)13(8)3/h6-10,12,14-16H,1,4H2,2-3H3/t6-,7+,8-,9+,10-/m1/s1 |
| InChIKey | OXEQFLNYHMGQBL-MQIGXGKASA-N |
| XLogP | -1.55 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |