C8H15FN2O4 — CID 90064556
(2S,3R,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)-N-methylpiperidine-2-carboxamide (PubChem CID 90064556) has the molecular formula C8H15FN2O4 and a molecular weight of 222.22 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)-N-methylpiperidine-2-carboxamide.
| Compound Name | (2S,3R,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)-N-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 90064556 |
| Molecular Formula | C8H15FN2O4 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (2S,3R,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)-N-methylpiperidine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1N[C@H](CO)[C@@H](O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C8H15FN2O4/c1-10-8(15)5-7(14)4(9)6(13)3(2-12)11-5/h3-7,11-14H,2H2,1H3,(H,10,15)/t3-,4+,5+,6-,7+/m1/s1 |
| InChIKey | IFCXLKOQKYZZST-PZRMXXKTSA-N |
| XLogP | -2.88 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |