About 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine
3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine (PubChem CID 90065082) has the molecular formula C8H6ClI2N3
and a molecular weight of 433.42 g/mol. Its IUPAC name is 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine |
| PubChem CID | 90065082 |
| Molecular Formula | C8H6ClI2N3 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 432.83 |
| IUPAC Name | 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine |
| SMILES | Clc1cnc2c(I)cn(CCI)c2n1 |
| InChI | InChI=1S/C8H6ClI2N3/c9-6-3-12-7-5(11)4-14(2-1-10)8(7)13-6/h3-4H,1-2H2 |
| InChIKey | LOPKZLVSURQLJW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine?
The IUPAC name of 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine (CID 90065082) is 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine is Clc1cnc2c(I)cn(CCI)c2n1.
What is the InChIKey of 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine?
The InChIKey is LOPKZLVSURQLJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClI2N3/c9-6-3-12-7-5(11)4-14(2-1-10)8(7)13-6/h3-4H,1-2H2.
What are the key properties of 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine?
3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine has a molecular weight of 433.42 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-7-iodo-5-(2-iodoethyl)pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 90065082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).