About N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine
N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine (PubChem CID 90065158) has the molecular formula C12H21NO2
and a molecular weight of 211.31 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine |
| PubChem CID | 90065158 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine |
| SMILES | COCC(CNCC1=CCCC=C1)OC |
| InChI | InChI=1S/C12H21NO2/c1-14-10-12(15-2)9-13-8-11-6-4-3-5-7-11/h4,6-7,12-13H,3,5,8-10H2,1-2H3 |
| InChIKey | AKQFKLQWIVQDNE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine?
The IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine (CID 90065158) is N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine.
What is the SMILES notation for N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine?
The canonical SMILES for N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine is COCC(CNCC1=CCCC=C1)OC.
What is the InChIKey of N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine?
The InChIKey is AKQFKLQWIVQDNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-14-10-12(15-2)9-13-8-11-6-4-3-5-7-11/h4,6-7,12-13H,3,5,8-10H2,1-2H3.
What are the key properties of N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine?
N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine has a molecular weight of 211.31 g/mol, XLogP of 1.51, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-1-ylmethyl)-2,3-dimethoxypropan-1-amine is sourced from PubChem (CID 90065158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).