C11H18N4 — CID 90065483
[(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine (PubChem CID 90065483) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is [(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine.
| Compound Name | [(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine |
|---|---|
| PubChem CID | 90065483 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | [(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine |
| SMILES | Cn1nnc2c1CC[C@H]1[C@@H](CN)[C@H]1CC2 |
| InChI | InChI=1S/C11H18N4/c1-15-11-5-3-8-7(9(8)6-12)2-4-10(11)13-14-15/h7-9H,2-6,12H2,1H3/t7-,8+,9-/m0/s1 |
| InChIKey | XLZJKBLBNOWYRF-YIZRAAEISA-N |
| XLogP | 0.51 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |