C22H20N2O4 — CID 9006631
(2R)-2-(2,3-dihydroxyphenyl)-3-(4-ethoxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 9006631) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydroxyphenyl)-3-(4-ethoxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-2-(2,3-dihydroxyphenyl)-3-(4-ethoxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9006631 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2R)-2-(2,3-dihydroxyphenyl)-3-(4-ethoxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CCOc1ccc(N2C(=O)c3ccccc3N[C@H]2c2cccc(O)c2O)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-2-28-15-12-10-14(11-13-15)24-21(17-7-5-9-19(25)20(17)26)23-18-8-4-3-6-16(18)22(24)27/h3-13,21,23,25-26H,2H2,1H3/t21-/m1/s1 |
| InChIKey | HBBWRAQAZSJRTF-OAQYLSRUSA-N |
| XLogP | 4.27 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|