C20H21FN8OS — CID 90066315
4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-N-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-9H-pyrimido[4,5-b]indol-8-amine (PubChem CID 90066315) has the molecular formula C20H21FN8OS and a molecular weight of 440.51 g/mol. Its IUPAC name is 4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-N-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-9H-pyrimido[4,5-b]indol-8-amine.
| Compound Name | 4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-N-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-9H-pyrimido[4,5-b]indol-8-amine |
|---|---|
| PubChem CID | 90066315 |
| Molecular Formula | C20H21FN8OS |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-N-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-9H-pyrimido[4,5-b]indol-8-amine |
| SMILES | CNc1cc(F)cc2c1[nH]c1nc(Sc3nnc(C)o3)nc(N3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C20H21FN8OS/c1-8-27-28-20(30-8)31-19-25-17-15(12-4-10(21)5-14(23-2)16(12)24-17)18(26-19)29-7-9-3-11(29)6-13(9)22/h4-5,9,11,13,23H,3,6-7,22H2,1-2H3,(H,24,25,26)/t9-,11-,13-/m1/s1 |
| InChIKey | XPPHYLGRZZQOTK-IRUJWGPZSA-N |
| XLogP | 3.06 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |