C22H22FN7O2S2 — CID 90066340
methyl 5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-2-carboxylate (PubChem CID 90066340) has the molecular formula C22H22FN7O2S2 and a molecular weight of 499.60 g/mol. Its IUPAC name is methyl 5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-2-carboxylate.
| Compound Name | methyl 5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 90066340 |
| Molecular Formula | C22H22FN7O2S2 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | methyl 5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-2-carboxylate |
| SMILES | CNc1cc(F)cc2c1[nH]c1nc(Sc3cnc(C(=O)OC)s3)nc(N3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C22H22FN7O2S2/c1-25-14-5-10(23)4-12-16-18(27-17(12)14)28-22(34-15-7-26-20(33-15)21(31)32-2)29-19(16)30-8-9-3-11(30)6-13(9)24/h4-5,7,9,11,13,25H,3,6,8,24H2,1-2H3,(H,27,28,29)/t9-,11-,13-/m1/s1 |
| InChIKey | GXSJTMUUEWKPIC-IRUJWGPZSA-N |
| XLogP | 3.61 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |