C22H23FN8O2S — CID 90066376
methyl 5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-2-carboxylate (PubChem CID 90066376) has the molecular formula C22H23FN8O2S and a molecular weight of 482.55 g/mol. Its IUPAC name is methyl 5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-2-carboxylate.
| Compound Name | methyl 5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 90066376 |
| Molecular Formula | C22H23FN8O2S |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | methyl 5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-2-carboxylate |
| SMILES | CNc1cc(F)cc2c1[nH]c1nc(Nc3cnc(C(=O)OC)s3)nc(N3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C22H23FN8O2S/c1-25-14-5-10(23)4-12-16-18(28-17(12)14)29-22(27-15-7-26-20(34-15)21(32)33-2)30-19(16)31-8-9-3-11(31)6-13(9)24/h4-5,7,9,11,13,25H,3,6,8,24H2,1-2H3,(H2,27,28,29,30)/t9-,11-,13-/m1/s1 |
| InChIKey | BZJBOUKWMCZWTN-IRUJWGPZSA-N |
| XLogP | 3.20 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |