C23H25F2N8O5P — CID 90066603
[(1R)-1-[5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-5,6-difluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]oxy]pyrimidin-2-yl]ethyl] dihydrogen phosphate (PubChem CID 90066603) has the molecular formula C23H25F2N8O5P and a molecular weight of 562.47 g/mol. Its IUPAC name is [(1R)-1-[5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-5,6-difluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]oxy]pyrimidin-2-yl]ethyl] dihydrogen phosphate.
| Compound Name | [(1R)-1-[5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-5,6-difluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]oxy]pyrimidin-2-yl]ethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90066603 |
| Molecular Formula | C23H25F2N8O5P |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | [(1R)-1-[5-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-5,6-difluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]oxy]pyrimidin-2-yl]ethyl] dihydrogen phosphate |
| SMILES | CNc1cc(F)c(F)c2c1[nH]c1nc(Oc3cnc([C@@H](C)OP(=O)(O)O)nc3)nc(N3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C23H25F2N8O5P/c1-9(38-39(34,35)36)20-28-6-12(7-29-20)37-23-31-21-17(16-18(25)13(24)5-15(27-2)19(16)30-21)22(32-23)33-8-10-3-11(33)4-14(10)26/h5-7,9-11,14,27H,3-4,8,26H2,1-2H3,(H,30,31,32)(H2,34,35,36)/t9-,10-,11-,14-/m1/s1 |
| InChIKey | XKRUKZWFKQJCKY-ZHSDAYTOSA-N |
| XLogP | 3.11 |
| TPSA | 184.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|