C19H21ClF2N4O — CID 90067102
6-chloro-N-[4-(difluoromethyl)-2-pyridinyl]-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridin-2-amine (PubChem CID 90067102) has the molecular formula C19H21ClF2N4O and a molecular weight of 394.85 g/mol. Its IUPAC name is 6-chloro-N-[4-(difluoromethyl)-2-pyridinyl]-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridin-2-amine.
| Compound Name | 6-chloro-N-[4-(difluoromethyl)-2-pyridinyl]-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 90067102 |
| Molecular Formula | C19H21ClF2N4O |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 6-chloro-N-[4-(difluoromethyl)-2-pyridinyl]-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridin-2-amine |
| SMILES | FC(F)c1ccnc(Nc2cc(C3CCN(C4COC4)CC3)cc(Cl)n2)c1 |
| InChI | InChI=1S/C19H21ClF2N4O/c20-16-7-14(12-2-5-26(6-3-12)15-10-27-11-15)9-18(24-16)25-17-8-13(19(21)22)1-4-23-17/h1,4,7-9,12,15,19H,2-3,5-6,10-11H2,(H,23,24,25) |
| InChIKey | QPVWAPFWMFDGAL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|