C19H20Cl3N5O3 — CID 90067127
(2S)-1-[2-[2-(2-amino-2-oxoethanimidoyl)-5-chloroanilino]acetyl]-N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-2,3-dihydropyrrole-2-carboxamide (PubChem CID 90067127) has the molecular formula C19H20Cl3N5O3 and a molecular weight of 472.76 g/mol. Its IUPAC name is (2S)-1-[2-[2-(2-amino-2-oxoethanimidoyl)-5-chloroanilino]acetyl]-N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-2,3-dihydropyrrole-2-carboxamide.
| Compound Name | (2S)-1-[2-[2-(2-amino-2-oxoethanimidoyl)-5-chloroanilino]acetyl]-N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-2,3-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 90067127 |
| Molecular Formula | C19H20Cl3N5O3 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (2S)-1-[2-[2-(2-amino-2-oxoethanimidoyl)-5-chloroanilino]acetyl]-N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-2,3-dihydropyrrole-2-carboxamide |
| SMILES | [H]/N=C(\C(N)=O)c1ccc(Cl)cc1NCC(=O)N1C=CC[C@H]1C(=O)NC[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C19H20Cl3N5O3/c20-11-3-4-12(16(23)17(24)29)13(6-11)25-9-15(28)27-5-1-2-14(27)18(30)26-8-10-7-19(10,21)22/h1,3-6,10,14,23,25H,2,7-9H2,(H2,24,29)(H,26,30)/b23-16-/t10-,14+/m1/s1 |
| InChIKey | JMYCOXSGEKGUFO-JABXHOOYSA-N |
| XLogP | 2.03 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|