C16H16ClN3O6S — CID 90067202
(3R,3aR,6R,6aR)-6-[[6-chloro-5-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 90067202) has the molecular formula C16H16ClN3O6S and a molecular weight of 413.84 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 90067202 |
| Molecular Formula | C16H16ClN3O6S |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O=S1(=O)CC=C(c2nc3nc(O[C@@H]4CO[C@H]5[C@@H]4OC[C@H]5O)[nH]c3cc2Cl)C1 |
| InChI | InChI=1S/C16H16ClN3O6S/c17-8-3-9-15(19-12(8)7-1-2-27(22,23)6-7)20-16(18-9)26-11-5-25-13-10(21)4-24-14(11)13/h1,3,10-11,13-14,21H,2,4-6H2,(H,18,19,20)/t10-,11-,13-,14-/m1/s1 |
| InChIKey | WGUDMRAUXYCVHL-HBJVGIJOSA-N |
| XLogP | 0.33 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |