C28H26ClN3O5 — CID 90067295
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[4-(3-methyloxetan-3-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 90067295) has the molecular formula C28H26ClN3O5 and a molecular weight of 519.99 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[4-(3-methyloxetan-3-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[4-(3-methyloxetan-3-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 90067295 |
| Molecular Formula | C28H26ClN3O5 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[4-(3-methyloxetan-3-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CC1(c2ccc(-c3ccc(-c4nc5nc(O[C@@H]6CO[C@H]7[C@@H]6OC[C@H]7O)[nH]c5cc4Cl)cc3)cc2)COC1 |
| InChI | InChI=1S/C28H26ClN3O5/c1-28(13-34-14-28)18-8-6-16(7-9-18)15-2-4-17(5-3-15)23-19(29)10-20-26(31-23)32-27(30-20)37-22-12-36-24-21(33)11-35-25(22)24/h2-10,21-22,24-25,33H,11-14H2,1H3,(H,30,31,32)/t21-,22-,24-,25-/m1/s1 |
| InChIKey | GDOWFOSSOKWWHY-WMMXXEOUSA-N |
| XLogP | 4.14 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |