C28H24ClN5O4 — CID 90067315
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[4-(imidazol-1-ylmethyl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 90067315) has the molecular formula C28H24ClN5O4 and a molecular weight of 529.98 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[4-(imidazol-1-ylmethyl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[4-(imidazol-1-ylmethyl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 90067315 |
| Molecular Formula | C28H24ClN5O4 |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[4-(imidazol-1-ylmethyl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(-c3ccc(-c4ccc(Cn5ccnc5)cc4)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C28H24ClN5O4/c29-20-11-21-27(33-28(31-21)38-23-14-37-25-22(35)13-36-26(23)25)32-24(20)19-7-5-18(6-8-19)17-3-1-16(2-4-17)12-34-10-9-30-15-34/h1-11,15,22-23,25-26,35H,12-14H2,(H,31,32,33)/t22-,23-,25-,26-/m1/s1 |
| InChIKey | DJLOMMUNVLMNLN-OQUNMALSSA-N |
| XLogP | 4.10 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |