C27H24ClN3O4 — CID 90067327
2-[[(3R,3aR,6R,6aR)-3-prop-2-enoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 90067327) has the molecular formula C27H24ClN3O4 and a molecular weight of 489.96 g/mol. Its IUPAC name is 2-[[(3R,3aR,6R,6aR)-3-prop-2-enoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[[(3R,3aR,6R,6aR)-3-prop-2-enoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 90067327 |
| Molecular Formula | C27H24ClN3O4 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-[[(3R,3aR,6R,6aR)-3-prop-2-enoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | C=CCO[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(-c3ccc(-c4ccccc4)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C27H24ClN3O4/c1-2-12-32-21-14-33-25-22(15-34-24(21)25)35-27-29-20-13-19(28)23(30-26(20)31-27)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h2-11,13,21-22,24-25H,1,12,14-15H2,(H,29,30,31)/t21-,22-,24-,25-/m1/s1 |
| InChIKey | WKDWBQBJHGLXAD-WMMXXEOUSA-N |
| XLogP | 5.06 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|