C25H20ClN3O6 — CID 90067543
4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]benzoic acid (PubChem CID 90067543) has the molecular formula C25H20ClN3O6 and a molecular weight of 493.90 g/mol. Its IUPAC name is 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]benzoic acid.
| Compound Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 90067543 |
| Molecular Formula | C25H20ClN3O6 |
| Molecular Weight | 493.90 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(-c3nc4nc(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C25H20ClN3O6/c26-16-9-17-23(29-25(27-17)35-19-11-34-21-18(30)10-33-22(19)21)28-20(16)14-5-1-12(2-6-14)13-3-7-15(8-4-13)24(31)32/h1-9,18-19,21-22,30H,10-11H2,(H,31,32)(H,27,28,29)/t18-,19-,21-,22-/m1/s1 |
| InChIKey | ABXPXEBYYPZMFY-UGESXGAOSA-N |
| XLogP | 3.55 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.90 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |