C18H27NO4S — CID 90067671
tert-butyl N-[2-(1,1-dioxo-4-phenylthian-4-yl)ethyl]carbamate (PubChem CID 90067671) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is tert-butyl N-[2-(1,1-dioxo-4-phenylthian-4-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1,1-dioxo-4-phenylthian-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 90067671 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | tert-butyl N-[2-(1,1-dioxo-4-phenylthian-4-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC1(c2ccccc2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C18H27NO4S/c1-17(2,3)23-16(20)19-12-9-18(15-7-5-4-6-8-15)10-13-24(21,22)14-11-18/h4-8H,9-14H2,1-3H3,(H,19,20) |
| InChIKey | UOGISBBEJDQSHV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |