C99H108N2O6 — CID 90067720
3,5-bis[4-[3,6-bis[4-(2-ethylhexoxy)phenyl]carbazol-9-yl]phenyl]benzoic acid (PubChem CID 90067720) has the molecular formula C99H108N2O6 and a molecular weight of 1421.96 g/mol. Its IUPAC name is 3,5-bis[4-[3,6-bis[4-(2-ethylhexoxy)phenyl]carbazol-9-yl]phenyl]benzoic acid.
| Compound Name | 3,5-bis[4-[3,6-bis[4-(2-ethylhexoxy)phenyl]carbazol-9-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 90067720 |
| Molecular Formula | C99H108N2O6 |
| Molecular Weight | 1421.96 g/mol |
| Exact Mass | 1420.82 |
| IUPAC Name | 3,5-bis[4-[3,6-bis[4-(2-ethylhexoxy)phenyl]carbazol-9-yl]phenyl]benzoic acid |
| SMILES | CCCCC(CC)COc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(OCC(CC)CCCC)cc4)ccc2n3-c2ccc(-c3cc(C(=O)O)cc(-c4ccc(-n5c6ccc(-c7ccc(OCC(CC)CCCC)cc7)cc6c6cc(-c7ccc(OCC(CC)CCCC)cc7)ccc65)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C99H108N2O6/c1-9-17-21-68(13-5)64-104-87-45-29-72(30-46-87)78-37-53-95-91(60-78)92-61-79(73-31-47-88(48-32-73)105-65-69(14-6)22-18-10-2)38-54-96(92)100(95)85-41-25-76(26-42-85)82-57-83(59-84(58-82)99(102)103)77-27-43-86(44-28-77)101-97-55-39-80(74-33-49-89(50-34-74)106-66-70(15-7)23-19-11-3)62-93(97)94-63-81(40-56-98(94)101)75-35-51-90(52-36-75)107-67-71(16-8)24-20-12-4/h25-63,68-71H,9-24,64-67H2,1-8H3,(H,102,103) |
| InChIKey | AKNJYWAUEOEFEP-UHFFFAOYSA-N |
| XLogP | 27.96 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 107 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1421.96 |
| LogP ≤ 5 | 27.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |