C83H76N2O6 — CID 90067753
3,5-bis[4-[3,6-bis(4-butoxyphenyl)carbazol-9-yl]phenyl]benzoic acid (PubChem CID 90067753) has the molecular formula C83H76N2O6 and a molecular weight of 1197.53 g/mol. Its IUPAC name is 3,5-bis[4-[3,6-bis(4-butoxyphenyl)carbazol-9-yl]phenyl]benzoic acid.
| Compound Name | 3,5-bis[4-[3,6-bis(4-butoxyphenyl)carbazol-9-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 90067753 |
| Molecular Formula | C83H76N2O6 |
| Molecular Weight | 1197.53 g/mol |
| Exact Mass | 1196.57 |
| IUPAC Name | 3,5-bis[4-[3,6-bis(4-butoxyphenyl)carbazol-9-yl]phenyl]benzoic acid |
| SMILES | CCCCOc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(OCCCC)cc4)ccc2n3-c2ccc(-c3cc(C(=O)O)cc(-c4ccc(-n5c6ccc(-c7ccc(OCCCC)cc7)cc6c6cc(-c7ccc(OCCCC)cc7)ccc65)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C83H76N2O6/c1-5-9-45-88-71-33-17-56(18-34-71)62-25-41-79-75(52-62)76-53-63(57-19-35-72(36-20-57)89-46-10-6-2)26-42-80(76)84(79)69-29-13-60(14-30-69)66-49-67(51-68(50-66)83(86)87)61-15-31-70(32-16-61)85-81-43-27-64(58-21-37-73(38-22-58)90-47-11-7-3)54-77(81)78-55-65(28-44-82(78)85)59-23-39-74(40-24-59)91-48-12-8-4/h13-44,49-55H,5-12,45-48H2,1-4H3,(H,86,87) |
| InChIKey | RZDQKYCNZCZJIH-UHFFFAOYSA-N |
| XLogP | 22.30 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1197.53 |
| LogP ≤ 5 | 22.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|