C25H24F6N2O — CID 90068392
2-[4-[[5-(6,6-dimethyl-1H-pyridin-2-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 90068392) has the molecular formula C25H24F6N2O and a molecular weight of 482.47 g/mol. Its IUPAC name is 2-[4-[[5-(6,6-dimethyl-1H-pyridin-2-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[[5-(6,6-dimethyl-1H-pyridin-2-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 90068392 |
| Molecular Formula | C25H24F6N2O |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 2-[4-[[5-(6,6-dimethyl-1H-pyridin-2-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC1(C)C=CC=C(c2ccc3c(c2)CCN3Cc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)N1 |
| InChI | InChI=1S/C25H24F6N2O/c1-22(2)12-3-4-20(32-22)17-7-10-21-18(14-17)11-13-33(21)15-16-5-8-19(9-6-16)23(34,24(26,27)28)25(29,30)31/h3-10,12,14,32,34H,11,13,15H2,1-2H3 |
| InChIKey | BHFOEUXFILZOSK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|