C24H23F6N3O2 — CID 90068404
N-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-3-[2-methyl-5-(5-methyl-1H-pyrazol-3-yl)phenyl]propanamide (PubChem CID 90068404) has the molecular formula C24H23F6N3O2 and a molecular weight of 499.46 g/mol. Its IUPAC name is N-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-3-[2-methyl-5-(5-methyl-1H-pyrazol-3-yl)phenyl]propanamide.
| Compound Name | N-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-3-[2-methyl-5-(5-methyl-1H-pyrazol-3-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 90068404 |
| Molecular Formula | C24H23F6N3O2 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-3-[2-methyl-5-(5-methyl-1H-pyrazol-3-yl)phenyl]propanamide |
| SMILES | Cc1cc(-c2ccc(C)c(CCC(=O)NCc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)c2)n[nH]1 |
| InChI | InChI=1S/C24H23F6N3O2/c1-14-3-6-18(20-11-15(2)32-33-20)12-17(14)7-10-21(34)31-13-16-4-8-19(9-5-16)22(35,23(25,26)27)24(28,29)30/h3-6,8-9,11-12,35H,7,10,13H2,1-2H3,(H,31,34)(H,32,33) |
| InChIKey | KNNYBPDCXKYGAO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |