About (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate
(9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate (PubChem CID 90068413) has the molecular formula C20H21N3O3S
and a molecular weight of 383.47 g/mol. Its IUPAC name is (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate.
Molecular Properties
| Compound Name | (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate |
| PubChem CID | 90068413 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate |
| SMILES | CN1C2COCC1CC(OC(=O)c1cn(-c3ccsn3)c3ccccc13)C2 |
| InChI | InChI=1S/C20H21N3O3S/c1-22-13-8-15(9-14(22)12-25-11-13)26-20(24)17-10-23(19-6-7-27-21-19)18-5-3-2-4-16(17)18/h2-7,10,13-15H,8-9,11-12H2,1H3 |
| InChIKey | IMTMGMMJRUWLOU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate?
The IUPAC name of (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate (CID 90068413) is (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate.
What is the SMILES notation for (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate?
The canonical SMILES for (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate is CN1C2COCC1CC(OC(=O)c1cn(-c3ccsn3)c3ccccc13)C2.
What is the InChIKey of (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate?
The InChIKey is IMTMGMMJRUWLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O3S/c1-22-13-8-15(9-14(22)12-25-11-13)26-20(24)17-10-23(19-6-7-27-21-19)18-5-3-2-4-16(17)18/h2-7,10,13-15H,8-9,11-12H2,1H3.
What are the key properties of (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate?
(9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate has a molecular weight of 383.47 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 1-(1,2-thiazol-3-yl)indole-3-carboxylate is sourced from PubChem (CID 90068413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).