C41H31F2N3 — CID 90068493
2-[7-(3,5-difluorophenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 90068493) has the molecular formula C41H31F2N3 and a molecular weight of 603.72 g/mol. Its IUPAC name is 2-[7-(3,5-difluorophenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7-(3,5-difluorophenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 90068493 |
| Molecular Formula | C41H31F2N3 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 2-[7-(3,5-difluorophenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)C2=C(c3ccc(-c4cc(F)cc(F)c4)cc31)C(C)(C)c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc12 |
| InChI | InChI=1S/C41H31F2N3/c1-40(2)33-21-26(28-19-29(42)23-30(43)20-28)15-17-31(33)35-36(40)32-18-16-27(22-34(32)41(35,3)4)39-45-37(24-11-7-5-8-12-24)44-38(46-39)25-13-9-6-10-14-25/h5-23H,1-4H3 |
| InChIKey | KUKIGJLNJAGXTB-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|