C36H28F2N2 — CID 90068505
2-[2-(3,5-difluorophenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-7-yl]-6-pyridin-4-ylpyridine (PubChem CID 90068505) has the molecular formula C36H28F2N2 and a molecular weight of 526.63 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-7-yl]-6-pyridin-4-ylpyridine.
| Compound Name | 2-[2-(3,5-difluorophenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-7-yl]-6-pyridin-4-ylpyridine |
|---|---|
| PubChem CID | 90068505 |
| Molecular Formula | C36H28F2N2 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-7-yl]-6-pyridin-4-ylpyridine |
| SMILES | CC1(C)C2=C(c3ccc(-c4cc(F)cc(F)c4)cc31)C(C)(C)c1cc(-c3cccc(-c4ccncc4)n3)ccc12 |
| InChI | InChI=1S/C36H28F2N2/c1-35(2)29-18-22(24-16-25(37)20-26(38)17-24)8-10-27(29)33-34(35)28-11-9-23(19-30(28)36(33,3)4)32-7-5-6-31(40-32)21-12-14-39-15-13-21/h5-20H,1-4H3 |
| InChIKey | ZTCMWOZMQCAJKR-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|