About 3-butoxy-1,2-diethylpyridin-4-one
3-butoxy-1,2-diethylpyridin-4-one (PubChem CID 90068943) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-butoxy-1,2-diethylpyridin-4-one.
Molecular Properties
| Compound Name | 3-butoxy-1,2-diethylpyridin-4-one |
| PubChem CID | 90068943 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 3-butoxy-1,2-diethylpyridin-4-one |
| SMILES | CCCCOc1c(CC)n(CC)ccc1=O |
| InChI | InChI=1S/C13H21NO2/c1-4-7-10-16-13-11(5-2)14(6-3)9-8-12(13)15/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | QQCVFEKTTCRLKZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-1,2-diethylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-1,2-diethylpyridin-4-one?
The IUPAC name of 3-butoxy-1,2-diethylpyridin-4-one (CID 90068943) is 3-butoxy-1,2-diethylpyridin-4-one.
What is the SMILES notation for 3-butoxy-1,2-diethylpyridin-4-one?
The canonical SMILES for 3-butoxy-1,2-diethylpyridin-4-one is CCCCOc1c(CC)n(CC)ccc1=O.
What is the InChIKey of 3-butoxy-1,2-diethylpyridin-4-one?
The InChIKey is QQCVFEKTTCRLKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2/c1-4-7-10-16-13-11(5-2)14(6-3)9-8-12(13)15/h8-9H,4-7,10H2,1-3H3.
What are the key properties of 3-butoxy-1,2-diethylpyridin-4-one?
3-butoxy-1,2-diethylpyridin-4-one has a molecular weight of 223.32 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-1,2-diethylpyridin-4-one is sourced from PubChem (CID 90068943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).