C19H18F4N4OS — CID 90069043
(4aR,7aS)-7a-(2-fluorophenyl)-6-[6-methoxy-4-(trifluoromethyl)-2-pyridinyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine (PubChem CID 90069043) has the molecular formula C19H18F4N4OS and a molecular weight of 426.44 g/mol. Its IUPAC name is (4aR,7aS)-7a-(2-fluorophenyl)-6-[6-methoxy-4-(trifluoromethyl)-2-pyridinyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,7aS)-7a-(2-fluorophenyl)-6-[6-methoxy-4-(trifluoromethyl)-2-pyridinyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 90069043 |
| Molecular Formula | C19H18F4N4OS |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (4aR,7aS)-7a-(2-fluorophenyl)-6-[6-methoxy-4-(trifluoromethyl)-2-pyridinyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
| SMILES | COc1cc(C(F)(F)F)cc(N2C[C@H]3CSC(N)=N[C@@]3(c3ccccc3F)C2)n1 |
| InChI | InChI=1S/C19H18F4N4OS/c1-28-16-7-11(19(21,22)23)6-15(25-16)27-8-12-9-29-17(24)26-18(12,10-27)13-4-2-3-5-14(13)20/h2-7,12H,8-10H2,1H3,(H2,24,26)/t12-,18-/m0/s1 |
| InChIKey | YUCTWYFEOBPLTL-SGTLLEGYSA-N |
| XLogP | 3.64 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |