C15H13NO4S — CID 90069200
(5E)-5-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-9-thia-3-azatricyclo[6.3.0.02,6]undeca-1(8),10-dien-4-one (PubChem CID 90069200) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is (5E)-5-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-9-thia-3-azatricyclo[6.3.0.02,6]undeca-1(8),10-dien-4-one.
| Compound Name | (5E)-5-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-9-thia-3-azatricyclo[6.3.0.02,6]undeca-1(8),10-dien-4-one |
|---|---|
| PubChem CID | 90069200 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (5E)-5-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-9-thia-3-azatricyclo[6.3.0.02,6]undeca-1(8),10-dien-4-one |
| SMILES | CC1=CC(O/C=C2/C(=O)NC3c4ccsc4CC23)OC1=O |
| InChI | InChI=1S/C15H13NO4S/c1-7-4-12(20-15(7)18)19-6-10-9-5-11-8(2-3-21-11)13(9)16-14(10)17/h2-4,6,9,12-13H,5H2,1H3,(H,16,17)/b10-6+ |
| InChIKey | LRHCZBXSSWJABM-UXBLZVDNSA-N |
| XLogP | 1.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|