About (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide
(2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide (PubChem CID 90069427) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide.
Molecular Properties
| Compound Name | (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide |
| PubChem CID | 90069427 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide |
| SMILES | CNC(=O)[C@H](C)[C@@H](OC)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H20N2O2/c1-7(10(13)11-2)9(14-3)8-5-4-6-12-8/h7-9,12H,4-6H2,1-3H3,(H,11,13)/t7-,8+,9-/m1/s1 |
| InChIKey | LGKOIUOHLWHLMK-HRDYMLBCSA-N |
| XLogP | 0.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide?
The IUPAC name of (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide (CID 90069427) is (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide.
What is the SMILES notation for (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide?
The canonical SMILES for (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide is CNC(=O)[C@H](C)[C@@H](OC)[C@@H]1CCCN1.
What is the InChIKey of (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide?
The InChIKey is LGKOIUOHLWHLMK-HRDYMLBCSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-7(10(13)11-2)9(14-3)8-5-4-6-12-8/h7-9,12H,4-6H2,1-3H3,(H,11,13)/t7-,8+,9-/m1/s1.
What are the key properties of (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide?
(2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide has a molecular weight of 200.28 g/mol, XLogP of 0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-2-yl]propanamide is sourced from PubChem (CID 90069427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).