C36H26N3OP — CID 90070085
5,23-bis(2-methyl-4-pyridinyl)-1-aza-14λ5-phosphahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-2(7),3,5,8,10,12,15,17,19,21(26),22,24-dodecaene 14-oxide (PubChem CID 90070085) has the molecular formula C36H26N3OP and a molecular weight of 547.60 g/mol. Its IUPAC name is 5,23-bis(2-methyl-4-pyridinyl)-1-aza-14λ5-phosphahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-2(7),3,5,8,10,12,15,17,19,21(26),22,24-dodecaene 14-oxide.
| Compound Name | 5,23-bis(2-methyl-4-pyridinyl)-1-aza-14λ5-phosphahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-2(7),3,5,8,10,12,15,17,19,21(26),22,24-dodecaene 14-oxide |
|---|---|
| PubChem CID | 90070085 |
| Molecular Formula | C36H26N3OP |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 5,23-bis(2-methyl-4-pyridinyl)-1-aza-14λ5-phosphahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-2(7),3,5,8,10,12,15,17,19,21(26),22,24-dodecaene 14-oxide |
| SMILES | Cc1cc(-c2ccc3c(c2)-c2ccccc2P2(=O)c4ccccc4-c4cc(-c5ccnc(C)c5)ccc4N32)ccn1 |
| InChI | InChI=1S/C36H26N3OP/c1-23-19-27(15-17-37-23)25-11-13-33-31(21-25)29-7-3-5-9-35(29)41(40)36-10-6-4-8-30(36)32-22-26(12-14-34(32)39(33)41)28-16-18-38-24(2)20-28/h3-22H,1-2H3 |
| InChIKey | MHAGNCSZCCQTPW-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|