C15H10F12O4 — CID 90070113
[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] propanoate (PubChem CID 90070113) has the molecular formula C15H10F12O4 and a molecular weight of 482.22 g/mol. Its IUPAC name is [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] propanoate.
| Compound Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] propanoate |
|---|---|
| PubChem CID | 90070113 |
| Molecular Formula | C15H10F12O4 |
| Molecular Weight | 482.22 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10F12O4/c1-2-9(28)31-8-4-6(10(29,12(16,17)18)13(19,20)21)3-7(5-8)11(30,14(22,23)24)15(25,26)27/h3-5,29-30H,2H2,1H3 |
| InChIKey | ZHVJDZYEGDJTJN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|