C13H24O3 — CID 90070331
(1S,2S)-1-[(1S,4R,5R,8R)-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octan-4-yl]-2-methylbutan-1-ol (PubChem CID 90070331) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (1S,2S)-1-[(1S,4R,5R,8R)-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octan-4-yl]-2-methylbutan-1-ol.
| Compound Name | (1S,2S)-1-[(1S,4R,5R,8R)-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octan-4-yl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 90070331 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (1S,2S)-1-[(1S,4R,5R,8R)-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octan-4-yl]-2-methylbutan-1-ol |
| SMILES | CC[C@H](C)[C@H](O)[C@H]1CO[C@]2(C)OC[C@H]1[C@H]2C |
| InChI | InChI=1S/C13H24O3/c1-5-8(2)12(14)11-7-16-13(4)9(3)10(11)6-15-13/h8-12,14H,5-7H2,1-4H3/t8-,9+,10-,11-,12-,13-/m0/s1 |
| InChIKey | JNHUIUXCXLIFHW-FRTGSEIKSA-N |
| XLogP | 2.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |