C48H37N3O13 — CID 90070451
2-[2-[2-[2-[bis(carboxymethyl)amino]-4-cyano-5-(3-hydroxy-6-oxo-2,7-diphenylxanthen-9-yl)phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid (PubChem CID 90070451) has the molecular formula C48H37N3O13 and a molecular weight of 863.83 g/mol. Its IUPAC name is 2-[2-[2-[2-[bis(carboxymethyl)amino]-4-cyano-5-(3-hydroxy-6-oxo-2,7-diphenylxanthen-9-yl)phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid.
| Compound Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]-4-cyano-5-(3-hydroxy-6-oxo-2,7-diphenylxanthen-9-yl)phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 90070451 |
| Molecular Formula | C48H37N3O13 |
| Molecular Weight | 863.83 g/mol |
| Exact Mass | 863.23 |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]-4-cyano-5-(3-hydroxy-6-oxo-2,7-diphenylxanthen-9-yl)phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid |
| SMILES | N#Cc1cc(N(CC(=O)O)CC(=O)O)c(OCCOc2ccccc2N(CC(=O)O)CC(=O)O)cc1-c1c2cc(-c3ccccc3)c(=O)cc-2oc2cc(O)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C48H37N3O13/c49-23-30-17-37(51(26-46(58)59)27-47(60)61)43(63-16-15-62-40-14-8-7-13-36(40)50(24-44(54)55)25-45(56)57)20-33(30)48-34-18-31(28-9-3-1-4-10-28)38(52)21-41(34)64-42-22-39(53)32(19-35(42)48)29-11-5-2-6-12-29/h1-14,17-22,52H,15-16,24-27H2,(H,54,55)(H,56,57)(H,58,59)(H,60,61) |
| InChIKey | ICIASPHBQGTRQZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 248.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.83 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|