About 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one
6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one (PubChem CID 90070459) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one |
| PubChem CID | 90070459 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one |
| SMILES | O=C1CC(CO)Cc2sccc21 |
| InChI | InChI=1S/C9H10O2S/c10-5-6-3-8(11)7-1-2-12-9(7)4-6/h1-2,6,10H,3-5H2 |
| InChIKey | RJLWLBJZJHJPGD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
The IUPAC name of 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one (CID 90070459) is 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one.
What is the SMILES notation for 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
The canonical SMILES for 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one is O=C1CC(CO)Cc2sccc21.
What is the InChIKey of 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
The InChIKey is RJLWLBJZJHJPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c10-5-6-3-8(11)7-1-2-12-9(7)4-6/h1-2,6,10H,3-5H2.
What are the key properties of 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one has a molecular weight of 182.24 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one is sourced from PubChem (CID 90070459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).