C15H23F3O6S — CID 90071111
4-[2-[(4R)-2-bicyclo[2.2.1]heptanyl]propan-2-yloxycarbonyloxy]-1,1,2-trifluorobutane-1-sulfonic acid (PubChem CID 90071111) has the molecular formula C15H23F3O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is 4-[2-[(4R)-2-bicyclo[2.2.1]heptanyl]propan-2-yloxycarbonyloxy]-1,1,2-trifluorobutane-1-sulfonic acid.
| Compound Name | 4-[2-[(4R)-2-bicyclo[2.2.1]heptanyl]propan-2-yloxycarbonyloxy]-1,1,2-trifluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 90071111 |
| Molecular Formula | C15H23F3O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-[2-[(4R)-2-bicyclo[2.2.1]heptanyl]propan-2-yloxycarbonyloxy]-1,1,2-trifluorobutane-1-sulfonic acid |
| SMILES | CC(C)(OC(=O)OCCC(F)C(F)(F)S(=O)(=O)O)C1C[C@@H]2CCC1C2 |
| InChI | InChI=1S/C15H23F3O6S/c1-14(2,11-8-9-3-4-10(11)7-9)24-13(19)23-6-5-12(16)15(17,18)25(20,21)22/h9-12H,3-8H2,1-2H3,(H,20,21,22)/t9-,10?,11?,12?/m1/s1 |
| InChIKey | ZJEOLHIKSBJVCY-QBWABLMJSA-N |
| XLogP | 3.56 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|