About 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine
6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine (PubChem CID 90071173) has the molecular formula C27H21FN4
and a molecular weight of 420.49 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine.
Molecular Properties
| Compound Name | 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine |
| PubChem CID | 90071173 |
| Molecular Formula | C27H21FN4 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine |
| SMILES | Cc1cc(-c2ccc(CNc3nccc4cc(-c5ccccc5F)ncc34)cc2)ccn1 |
| InChI | InChI=1S/C27H21FN4/c1-18-14-21(10-12-29-18)20-8-6-19(7-9-20)16-32-27-24-17-31-26(15-22(24)11-13-30-27)23-4-2-3-5-25(23)28/h2-15,17H,16H2,1H3,(H,30,32) |
| InChIKey | HUDOSUGZLIXSEU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine?
The IUPAC name of 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine (CID 90071173) is 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine.
What is the SMILES notation for 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine?
The canonical SMILES for 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine is Cc1cc(-c2ccc(CNc3nccc4cc(-c5ccccc5F)ncc34)cc2)ccn1.
What is the InChIKey of 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine?
The InChIKey is HUDOSUGZLIXSEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21FN4/c1-18-14-21(10-12-29-18)20-8-6-19(7-9-20)16-32-27-24-17-31-26(15-22(24)11-13-30-27)23-4-2-3-5-25(23)28/h2-15,17H,16H2,1H3,(H,30,32).
What are the key properties of 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine?
6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine has a molecular weight of 420.49 g/mol, XLogP of 6.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluorophenyl)-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-2,7-naphthyridin-1-amine is sourced from PubChem (CID 90071173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).