About CID 90071189
CID 90071189 (PubChem CID 90071189) has the molecular formula C14H8BBr
and a molecular weight of 266.93 g/mol.
Molecular Properties
| Compound Name | CID 90071189 |
| PubChem CID | 90071189 |
| Molecular Formula | C14H8BBr |
| Molecular Weight | 266.93 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | — |
| SMILES | [B]c1c2ccccc2c(Br)c2ccccc12 |
| InChI | InChI=1S/C14H8BBr/c15-13-9-5-1-3-7-11(9)14(16)12-8-4-2-6-10(12)13/h1-8H |
| InChIKey | XFVCAOSRKZXNBS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 90071189 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90071189?
The IUPAC name of CID 90071189 (CID 90071189) is not available.
What is the SMILES notation for CID 90071189?
The canonical SMILES for CID 90071189 is [B]c1c2ccccc2c(Br)c2ccccc12.
What is the InChIKey of CID 90071189?
The InChIKey is XFVCAOSRKZXNBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BBr/c15-13-9-5-1-3-7-11(9)14(16)12-8-4-2-6-10(12)13/h1-8H.
What are the key properties of CID 90071189?
CID 90071189 has a molecular weight of 266.93 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90071189 is sourced from PubChem (CID 90071189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).