C43H37N — CID 90071194
(2Z)-N-[3-(10,10-dimethyl-14,21-diphenyl-7-pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,11,13,15,17,19-decaenyl)propyl]penta-2,4-dien-1-imine (PubChem CID 90071194) has the molecular formula C43H37N and a molecular weight of 567.78 g/mol. Its IUPAC name is (2Z)-N-[3-(10,10-dimethyl-14,21-diphenyl-7-pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,11,13,15,17,19-decaenyl)propyl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-N-[3-(10,10-dimethyl-14,21-diphenyl-7-pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,11,13,15,17,19-decaenyl)propyl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 90071194 |
| Molecular Formula | C43H37N |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | (2Z)-N-[3-(10,10-dimethyl-14,21-diphenyl-7-pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,11,13,15,17,19-decaenyl)propyl]penta-2,4-dien-1-imine |
| SMILES | C=C/C=C\C=N\CCCc1ccc2c(c1)C(C)(C)c1cc3c(-c4ccccc4)c4ccccc4c(-c4ccccc4)c3cc1-2 |
| InChI | InChI=1S/C43H37N/c1-4-5-14-25-44-26-15-16-30-23-24-33-36-28-37-38(29-40(36)43(2,3)39(33)27-30)42(32-19-10-7-11-20-32)35-22-13-12-21-34(35)41(37)31-17-8-6-9-18-31/h4-14,17-25,27-29H,1,15-16,26H2,2-3H3/b14-5-,44-25+ |
| InChIKey | DBPIDPHZPVVFHG-DSJCIKFXSA-N |
| XLogP | 11.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|