About 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid
2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid (PubChem CID 90071495) has the molecular formula C6H12N4O3
and a molecular weight of 188.19 g/mol. Its IUPAC name is 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid |
| PubChem CID | 90071495 |
| Molecular Formula | C6H12N4O3 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid |
| SMILES | CNC(=O)C(NCC(=O)O)=C(N)N |
| InChI | InChI=1S/C6H12N4O3/c1-9-6(13)4(5(7)8)10-2-3(11)12/h10H,2,7-8H2,1H3,(H,9,13)(H,11,12) |
| InChIKey | YBQNAOLYAOKVCQ-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid?
The IUPAC name of 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid (CID 90071495) is 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid.
What is the SMILES notation for 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid?
The canonical SMILES for 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid is CNC(=O)C(NCC(=O)O)=C(N)N.
What is the InChIKey of 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid?
The InChIKey is YBQNAOLYAOKVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O3/c1-9-6(13)4(5(7)8)10-2-3(11)12/h10H,2,7-8H2,1H3,(H,9,13)(H,11,12).
What are the key properties of 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid?
2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid has a molecular weight of 188.19 g/mol, XLogP of -2.51, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1,1-diamino-3-(methylamino)-3-oxoprop-1-en-2-yl]amino]acetic acid is sourced from PubChem (CID 90071495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).