C13H17NO2 — CID 90071602
methyl 2-(aminomethyl)-1-(4-methylphenyl)cyclopropane-1-carboxylate (PubChem CID 90071602) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-1-(4-methylphenyl)cyclopropane-1-carboxylate.
| Compound Name | methyl 2-(aminomethyl)-1-(4-methylphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 90071602 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | methyl 2-(aminomethyl)-1-(4-methylphenyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(C)cc2)CC1CN |
| InChI | InChI=1S/C13H17NO2/c1-9-3-5-10(6-4-9)13(12(15)16-2)7-11(13)8-14/h3-6,11H,7-8,14H2,1-2H3 |
| InChIKey | FGCJQBOZSLEORZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |