About N-(2,3,3-trifluoroprop-2-enyl)propanamide
N-(2,3,3-trifluoroprop-2-enyl)propanamide (PubChem CID 90071770) has the molecular formula C6H8F3NO
and a molecular weight of 167.13 g/mol. Its IUPAC name is N-(2,3,3-trifluoroprop-2-enyl)propanamide.
Molecular Properties
| Compound Name | N-(2,3,3-trifluoroprop-2-enyl)propanamide |
| PubChem CID | 90071770 |
| Molecular Formula | C6H8F3NO |
| Molecular Weight | 167.13 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | N-(2,3,3-trifluoroprop-2-enyl)propanamide |
| SMILES | CCC(=O)NCC(F)=C(F)F |
| InChI | InChI=1S/C6H8F3NO/c1-2-5(11)10-3-4(7)6(8)9/h2-3H2,1H3,(H,10,11) |
| InChIKey | CAUDNSFWINMOEX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.13 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,3,3-trifluoroprop-2-enyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3,3-trifluoroprop-2-enyl)propanamide?
The IUPAC name of N-(2,3,3-trifluoroprop-2-enyl)propanamide (CID 90071770) is N-(2,3,3-trifluoroprop-2-enyl)propanamide.
What is the SMILES notation for N-(2,3,3-trifluoroprop-2-enyl)propanamide?
The canonical SMILES for N-(2,3,3-trifluoroprop-2-enyl)propanamide is CCC(=O)NCC(F)=C(F)F.
What is the InChIKey of N-(2,3,3-trifluoroprop-2-enyl)propanamide?
The InChIKey is CAUDNSFWINMOEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3NO/c1-2-5(11)10-3-4(7)6(8)9/h2-3H2,1H3,(H,10,11).
What are the key properties of N-(2,3,3-trifluoroprop-2-enyl)propanamide?
N-(2,3,3-trifluoroprop-2-enyl)propanamide has a molecular weight of 167.13 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3,3-trifluoroprop-2-enyl)propanamide is sourced from PubChem (CID 90071770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).