C10H12F3N3O6S — CID 90071815
[2-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrrol-3-yl]methyl methanesulfonate (PubChem CID 90071815) has the molecular formula C10H12F3N3O6S and a molecular weight of 359.28 g/mol. Its IUPAC name is [2-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrrol-3-yl]methyl methanesulfonate.
| Compound Name | [2-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrrol-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 90071815 |
| Molecular Formula | C10H12F3N3O6S |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | [2-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrrol-3-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1ccn(CC(=O)NCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12F3N3O6S/c1-23(20,21)22-5-7-2-3-15(9(7)16(18)19)4-8(17)14-6-10(11,12)13/h2-3H,4-6H2,1H3,(H,14,17) |
| InChIKey | VZIDSJTYBQWLGO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|