About [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate
[1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate (PubChem CID 90071816) has the molecular formula C11H15F2N3O6S
and a molecular weight of 355.32 g/mol. Its IUPAC name is [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate |
| PubChem CID | 90071816 |
| Molecular Formula | C11H15F2N3O6S |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate |
| SMILES | CC(F)(F)CNC(=O)Cn1ccc(COS(C)(=O)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15F2N3O6S/c1-11(12,13)7-14-9(17)5-15-4-3-8(10(15)16(18)19)6-22-23(2,20)21/h3-4H,5-7H2,1-2H3,(H,14,17) |
| InChIKey | ITNQDUKFJKTXMT-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate?
The IUPAC name of [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate (CID 90071816) is [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate.
What is the SMILES notation for [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate?
The canonical SMILES for [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate is CC(F)(F)CNC(=O)Cn1ccc(COS(C)(=O)=O)c1[N+](=O)[O-].
What is the InChIKey of [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate?
The InChIKey is ITNQDUKFJKTXMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N3O6S/c1-11(12,13)7-14-9(17)5-15-4-3-8(10(15)16(18)19)6-22-23(2,20)21/h3-4H,5-7H2,1-2H3,(H,14,17).
What are the key properties of [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate?
[1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate has a molecular weight of 355.32 g/mol, XLogP of 0.64, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(2,2-difluoropropylamino)-2-oxoethyl]-2-nitropyrrol-3-yl]methyl methanesulfonate is sourced from PubChem (CID 90071816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).