C23H28N3O5S- — CID 90071995
(1aR,7bS)-4-carboxy-5-[2-[4-(dimethylamino)butylamino]-N-sulfinatoanilino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene (PubChem CID 90071995) has the molecular formula C23H28N3O5S- and a molecular weight of 458.56 g/mol. Its IUPAC name is (1aR,7bS)-4-carboxy-5-[2-[4-(dimethylamino)butylamino]-N-sulfinatoanilino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene.
| Compound Name | (1aR,7bS)-4-carboxy-5-[2-[4-(dimethylamino)butylamino]-N-sulfinatoanilino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene |
|---|---|
| PubChem CID | 90071995 |
| Molecular Formula | C23H28N3O5S- |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (1aR,7bS)-4-carboxy-5-[2-[4-(dimethylamino)butylamino]-N-sulfinatoanilino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene |
| SMILES | CN(C)CCCCNc1ccccc1N(c1ccc2c(c1C(=O)O)OC[C@@H]1C[C@H]21)S(=O)[O-] |
| InChI | InChI=1S/C23H29N3O5S/c1-25(2)12-6-5-11-24-18-7-3-4-8-19(18)26(32(29)30)20-10-9-16-17-13-15(17)14-31-22(16)21(20)23(27)28/h3-4,7-10,15,17,24H,5-6,11-14H2,1-2H3,(H,27,28)(H,29,30)/p-1/t15-,17-/m0/s1 |
| InChIKey | MRFCIXWQRGXVPW-RDJZCZTQSA-M |
| XLogP | 3.57 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|