C21H16Cl3F3N2O3 — CID 90072294
1-ethyl-6-methyl-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]indole-5-carboxylic acid (PubChem CID 90072294) has the molecular formula C21H16Cl3F3N2O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is 1-ethyl-6-methyl-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]indole-5-carboxylic acid.
| Compound Name | 1-ethyl-6-methyl-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 90072294 |
| Molecular Formula | C21H16Cl3F3N2O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | 1-ethyl-6-methyl-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]indole-5-carboxylic acid |
| SMILES | CCn1c(C(=O)NC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc2cc(C(=O)O)c(C)cc21 |
| InChI | InChI=1S/C21H16Cl3F3N2O3/c1-3-29-15-4-9(2)12(20(31)32)5-10(15)8-16(29)19(30)28-18(21(25,26)27)11-6-13(22)17(24)14(23)7-11/h4-8,18H,3H2,1-2H3,(H,28,30)(H,31,32) |
| InChIKey | AUHXXPYXZALVGG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|