About 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea
3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea (PubChem CID 900731) has the molecular formula C15H17N3OS
and a molecular weight of 287.39 g/mol. Its IUPAC name is 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea.
Molecular Properties
| Compound Name | 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea |
| PubChem CID | 900731 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)Nc1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C15H17N3OS/c1-4-8-18(9-5-2)15(19)17-12-6-7-13-14(10-12)20-11(3)16-13/h4-7,10H,1-2,8-9H2,3H3,(H,17,19) |
| InChIKey | OAKLPCNCHIPBBS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea?
The IUPAC name of 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea (CID 900731) is 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea.
What is the SMILES notation for 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea?
The canonical SMILES for 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea is C=CCN(CC=C)C(=O)Nc1ccc2nc(C)sc2c1.
What is the InChIKey of 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea?
The InChIKey is OAKLPCNCHIPBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3OS/c1-4-8-18(9-5-2)15(19)17-12-6-7-13-14(10-12)20-11(3)16-13/h4-7,10H,1-2,8-9H2,3H3,(H,17,19).
What are the key properties of 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea?
3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea has a molecular weight of 287.39 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3-benzothiazol-6-yl)-1,1-bis(prop-2-enyl)urea is sourced from PubChem (CID 900731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).