C17H19N — CID 90073204
2,3,4,4a,5,6-hexahydro-1H-isoquinolino[2,1-b]isoquinoline (PubChem CID 90073204) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 2,3,4,4a,5,6-hexahydro-1H-isoquinolino[2,1-b]isoquinoline.
| Compound Name | 2,3,4,4a,5,6-hexahydro-1H-isoquinolino[2,1-b]isoquinoline |
|---|---|
| PubChem CID | 90073204 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2,3,4,4a,5,6-hexahydro-1H-isoquinolino[2,1-b]isoquinoline |
| SMILES | C1=c2ccccc2=CN2CCC3CCCCC3=C12 |
| InChI | InChI=1S/C17H19N/c1-2-7-15-12-18-10-9-13-5-3-4-8-16(13)17(18)11-14(15)6-1/h1-2,6-7,11-13H,3-5,8-10H2 |
| InChIKey | SAOSTKFVIBNCIH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |