C20H26ClN8O+ — CID 90073426
3,5-diamino-N-[N'-[(3R)-1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 90073426) has the molecular formula C20H26ClN8O+ and a molecular weight of 429.94 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[(3R)-1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[(3R)-1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90073426 |
| Molecular Formula | C20H26ClN8O+ |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 3,5-diamino-N-[N'-[(3R)-1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | N/C(=N\[C@H]1C[N+]2(Cc3ccccc3)CCC1CC2)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C20H25ClN8O/c21-16-18(23)27-17(22)15(26-16)19(30)28-20(24)25-14-11-29(8-6-13(14)7-9-29)10-12-4-2-1-3-5-12/h1-5,13-14H,6-11H2,(H6-,22,23,24,25,27,28,30)/p+1/t13?,14-,29?/m0/s1 |
| InChIKey | NTSROCSHFXTHDE-WEKWXWCPSA-O |
| XLogP | 1.15 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|