About 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one
6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 90073616) has the molecular formula C6H10N2O2S
and a molecular weight of 174.22 g/mol. Its IUPAC name is 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one.
Molecular Properties
| Compound Name | 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| PubChem CID | 90073616 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N2CCCC(C2)N1OS |
| InChI | InChI=1S/C6H10N2O2S/c9-6-7-3-1-2-5(4-7)8(6)10-11/h5,11H,1-4H2 |
| InChIKey | HBAVILBRXQECDM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one?
The IUPAC name of 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one (CID 90073616) is 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one.
What is the SMILES notation for 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one?
The canonical SMILES for 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one is O=C1N2CCCC(C2)N1OS.
What is the InChIKey of 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one?
The InChIKey is HBAVILBRXQECDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2S/c9-6-7-3-1-2-5(4-7)8(6)10-11/h5,11H,1-4H2.
What are the key properties of 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one?
6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one has a molecular weight of 174.22 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one is sourced from PubChem (CID 90073616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).