C23H31BrClN9O2 — CID 90073685
3,5-diamino-6-chloro-N-[N'-[1-[(1S)-2-(ethylamino)-2-oxo-1-phenylethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide bromide (PubChem CID 90073685) has the molecular formula C23H31BrClN9O2 and a molecular weight of 580.92 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[1-[(1S)-2-(ethylamino)-2-oxo-1-phenylethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide bromide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[1-[(1S)-2-(ethylamino)-2-oxo-1-phenylethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide bromide |
|---|---|
| PubChem CID | 90073685 |
| Molecular Formula | C23H31BrClN9O2 |
| Molecular Weight | 580.92 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[1-[(1S)-2-(ethylamino)-2-oxo-1-phenylethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide bromide |
| SMILES | CCNC(=O)[C@H](c1ccccc1)[N+]12CCC(CC1)C(/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N)C2.[Br-] |
| InChI | InChI=1S/C23H30ClN9O2.BrH/c1-2-28-22(35)17(14-6-4-3-5-7-14)33-10-8-13(9-11-33)15(12-33)29-23(27)32-21(34)16-19(25)31-20(26)18(24)30-16;/h3-7,13,15,17H,2,8-12H2,1H3,(H7-,25,26,27,28,29,31,32,34,35);1H/t13?,15?,17-,33?;/m0./s1 |
| InChIKey | LQQICSIFOBNDAH-QGRIVIJDSA-N |
| XLogP | -2.17 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.92 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|